C15H17N3O3S — CID 120551387
2-[2-[[2-(1-methylpyrazol-4-yl)phenyl]methylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 120551387) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[2-[[2-(1-methylpyrazol-4-yl)phenyl]methylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[[2-(1-methylpyrazol-4-yl)phenyl]methylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 120551387 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[2-[[2-(1-methylpyrazol-4-yl)phenyl]methylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | Cn1cc(-c2ccccc2CNC(=O)CSCC(=O)O)cn1 |
| InChI | InChI=1S/C15H17N3O3S/c1-18-8-12(7-17-18)13-5-3-2-4-11(13)6-16-14(19)9-22-10-15(20)21/h2-5,7-8H,6,9-10H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | KXMIVPDTPNHXST-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |