C9H14N2O3S — CID 104571039
4-(morpholin-2-ylmethyl)thiomorpholine-3,5-dione (PubChem CID 104571039) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-(morpholin-2-ylmethyl)thiomorpholine-3,5-dione.
| Compound Name | 4-(morpholin-2-ylmethyl)thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 104571039 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-(morpholin-2-ylmethyl)thiomorpholine-3,5-dione |
| SMILES | O=C1CSCC(=O)N1CC1CNCCO1 |
| InChI | InChI=1S/C9H14N2O3S/c12-8-5-15-6-9(13)11(8)4-7-3-10-1-2-14-7/h7,10H,1-6H2 |
| InChIKey | ZKZRUZKGTPUECD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|