C12H19N3O3 — CID 64532844
3-(morpholin-2-ylmethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 64532844) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-(morpholin-2-ylmethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-(morpholin-2-ylmethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 64532844 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-(morpholin-2-ylmethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1CC1CNCCO1 |
| InChI | InChI=1S/C12H19N3O3/c16-10-12(3-1-2-4-12)14-11(17)15(10)8-9-7-13-5-6-18-9/h9,13H,1-8H2,(H,14,17) |
| InChIKey | LGJJTBZXBOIMKT-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|