C11H9ClN2O2S — CID 104573395
3-(4-chlorophenyl)-2-(1,3,4-thiadiazol-2-yl)propanoic acid (PubChem CID 104573395) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(1,3,4-thiadiazol-2-yl)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-(1,3,4-thiadiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 104573395 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(1,3,4-thiadiazol-2-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Cl)cc1)c1nncs1 |
| InChI | InChI=1S/C11H9ClN2O2S/c12-8-3-1-7(2-4-8)5-9(11(15)16)10-14-13-6-17-10/h1-4,6,9H,5H2,(H,15,16) |
| InChIKey | WCNZCOZORYWBND-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |