C17H17ClO2 — CID 82139348
3-(4-chlorophenyl)-2-(2,5-dimethylphenyl)propanoic acid (PubChem CID 82139348) has the molecular formula C17H17ClO2 and a molecular weight of 288.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(2,5-dimethylphenyl)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-(2,5-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 82139348 |
| Molecular Formula | C17H17ClO2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(2,5-dimethylphenyl)propanoic acid |
| SMILES | Cc1ccc(C)c(C(Cc2ccc(Cl)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C17H17ClO2/c1-11-3-4-12(2)15(9-11)16(17(19)20)10-13-5-7-14(18)8-6-13/h3-9,16H,10H2,1-2H3,(H,19,20) |
| InChIKey | PDTUCUNHKBGNMC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |