C17H17FO2 — CID 82139843
2-(2,5-dimethylphenyl)-3-(2-fluorophenyl)propanoic acid (PubChem CID 82139843) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-3-(2-fluorophenyl)propanoic acid.
| Compound Name | 2-(2,5-dimethylphenyl)-3-(2-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 82139843 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-3-(2-fluorophenyl)propanoic acid |
| SMILES | Cc1ccc(C)c(C(Cc2ccccc2F)C(=O)O)c1 |
| InChI | InChI=1S/C17H17FO2/c1-11-7-8-12(2)14(9-11)15(17(19)20)10-13-5-3-4-6-16(13)18/h3-9,15H,10H2,1-2H3,(H,19,20) |
| InChIKey | CUHCYRCVZMOUNC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |