C18H19FO3 — CID 83950996
2-(4-ethoxy-2-methylphenyl)-3-(2-fluorophenyl)propanoic acid (PubChem CID 83950996) has the molecular formula C18H19FO3 and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-(4-ethoxy-2-methylphenyl)-3-(2-fluorophenyl)propanoic acid.
| Compound Name | 2-(4-ethoxy-2-methylphenyl)-3-(2-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 83950996 |
| Molecular Formula | C18H19FO3 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(4-ethoxy-2-methylphenyl)-3-(2-fluorophenyl)propanoic acid |
| SMILES | CCOc1ccc(C(Cc2ccccc2F)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C18H19FO3/c1-3-22-14-8-9-15(12(2)10-14)16(18(20)21)11-13-6-4-5-7-17(13)19/h4-10,16H,3,11H2,1-2H3,(H,20,21) |
| InChIKey | JJUJMNANCGCMJC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |