C13H19BrN2O2 — CID 104578656
methyl 2-[(5-bromo-3-pyridinyl)methylamino]-3-methylpentanoate (PubChem CID 104578656) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is methyl 2-[(5-bromo-3-pyridinyl)methylamino]-3-methylpentanoate.
| Compound Name | methyl 2-[(5-bromo-3-pyridinyl)methylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 104578656 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | methyl 2-[(5-bromo-3-pyridinyl)methylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(NCc1cncc(Br)c1)C(=O)OC |
| InChI | InChI=1S/C13H19BrN2O2/c1-4-9(2)12(13(17)18-3)16-7-10-5-11(14)8-15-6-10/h5-6,8-9,12,16H,4,7H2,1-3H3 |
| InChIKey | OZWQTIUOAMNDKW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |