C14H7BrCl2N2O — CID 104578908
N-(4-bromo-2,3-dichlorophenyl)-4-cyanobenzamide (PubChem CID 104578908) has the molecular formula C14H7BrCl2N2O and a molecular weight of 370.03 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-4-cyanobenzamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-4-cyanobenzamide |
|---|---|
| PubChem CID | 104578908 |
| Molecular Formula | C14H7BrCl2N2O |
| Molecular Weight | 370.03 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-4-cyanobenzamide |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(Br)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C14H7BrCl2N2O/c15-10-5-6-11(13(17)12(10)16)19-14(20)9-3-1-8(7-18)2-4-9/h1-6H,(H,19,20) |
| InChIKey | JKCYBXRRHFHLBG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.03 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|