C9H16N2S2 — CID 104579941
N-(2-methylsulfanylethyl)-1-(5-methyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 104579941) has the molecular formula C9H16N2S2 and a molecular weight of 216.37 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-1-(5-methyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-(2-methylsulfanylethyl)-1-(5-methyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 104579941 |
| Molecular Formula | C9H16N2S2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | N-(2-methylsulfanylethyl)-1-(5-methyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | CSCCNC(C)c1ncc(C)s1 |
| InChI | InChI=1S/C9H16N2S2/c1-7-6-11-9(13-7)8(2)10-4-5-12-3/h6,8,10H,4-5H2,1-3H3 |
| InChIKey | XJMIXMHNGNXEBK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|