C15H21N3S — CID 107274588
2-[3-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]propyl]aniline (PubChem CID 107274588) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-[3-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]propyl]aniline.
| Compound Name | 2-[3-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]propyl]aniline |
|---|---|
| PubChem CID | 107274588 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-[3-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]propyl]aniline |
| SMILES | Cc1cnc(C(C)NCCCc2ccccc2N)s1 |
| InChI | InChI=1S/C15H21N3S/c1-11-10-18-15(19-11)12(2)17-9-5-7-13-6-3-4-8-14(13)16/h3-4,6,8,10,12,17H,5,7,9,16H2,1-2H3 |
| InChIKey | IVPRRDCGIDYUFH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|