C16H26N2O2 — CID 104582308
2-[1-[(1,3-dimethylpiperidin-4-yl)amino]ethyl]-5-methoxyphenol (PubChem CID 104582308) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[1-[(1,3-dimethylpiperidin-4-yl)amino]ethyl]-5-methoxyphenol.
| Compound Name | 2-[1-[(1,3-dimethylpiperidin-4-yl)amino]ethyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 104582308 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[1-[(1,3-dimethylpiperidin-4-yl)amino]ethyl]-5-methoxyphenol |
| SMILES | COc1ccc(C(C)NC2CCN(C)CC2C)c(O)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-11-10-18(3)8-7-15(11)17-12(2)14-6-5-13(20-4)9-16(14)19/h5-6,9,11-12,15,17,19H,7-8,10H2,1-4H3 |
| InChIKey | OGPUGLJOOIFGET-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|