C15H24N2O2 — CID 107707305
5-[1-[(1,3-dimethylpiperidin-4-yl)amino]ethyl]benzene-1,3-diol (PubChem CID 107707305) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 5-[1-[(1,3-dimethylpiperidin-4-yl)amino]ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-[(1,3-dimethylpiperidin-4-yl)amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107707305 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 5-[1-[(1,3-dimethylpiperidin-4-yl)amino]ethyl]benzene-1,3-diol |
| SMILES | CC(NC1CCN(C)CC1C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H24N2O2/c1-10-9-17(3)5-4-15(10)16-11(2)12-6-13(18)8-14(19)7-12/h6-8,10-11,15-16,18-19H,4-5,9H2,1-3H3 |
| InChIKey | AAFSYQILWMIWRE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |