C16H26N2 — CID 115710203
1,3-dimethyl-N-[1-(4-methylphenyl)ethyl]piperidin-4-amine (PubChem CID 115710203) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1,3-dimethyl-N-[1-(4-methylphenyl)ethyl]piperidin-4-amine.
| Compound Name | 1,3-dimethyl-N-[1-(4-methylphenyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 115710203 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1,3-dimethyl-N-[1-(4-methylphenyl)ethyl]piperidin-4-amine |
| SMILES | Cc1ccc(C(C)NC2CCN(C)CC2C)cc1 |
| InChI | InChI=1S/C16H26N2/c1-12-5-7-15(8-6-12)14(3)17-16-9-10-18(4)11-13(16)2/h5-8,13-14,16-17H,9-11H2,1-4H3 |
| InChIKey | FPFKOMHUNBZEBC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |