C18H32N2O2 — CID 104582736
tert-butyl 3-(hex-5-en-2-ylamino)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 104582736) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is tert-butyl 3-(hex-5-en-2-ylamino)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-(hex-5-en-2-ylamino)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 104582736 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | tert-butyl 3-(hex-5-en-2-ylamino)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=CCCC(C)NC1CC2CCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O2/c1-6-7-8-13(2)19-14-11-15-9-10-16(12-14)20(15)17(21)22-18(3,4)5/h6,13-16,19H,1,7-12H2,2-5H3 |
| InChIKey | ZORHKMLXRXINSM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|