C11H15F2NO2 — CID 104582778
3,5-difluoro-2-[1-(1-hydroxypropan-2-ylamino)ethyl]phenol (PubChem CID 104582778) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is 3,5-difluoro-2-[1-(1-hydroxypropan-2-ylamino)ethyl]phenol.
| Compound Name | 3,5-difluoro-2-[1-(1-hydroxypropan-2-ylamino)ethyl]phenol |
|---|---|
| PubChem CID | 104582778 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3,5-difluoro-2-[1-(1-hydroxypropan-2-ylamino)ethyl]phenol |
| SMILES | CC(CO)NC(C)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C11H15F2NO2/c1-6(5-15)14-7(2)11-9(13)3-8(12)4-10(11)16/h3-4,6-7,14-16H,5H2,1-2H3 |
| InChIKey | JSCYQBGAUPCDIF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|