C10H13F2NO — CID 104581572
2-[1-(ethylamino)ethyl]-3,5-difluorophenol (PubChem CID 104581572) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-[1-(ethylamino)ethyl]-3,5-difluorophenol.
| Compound Name | 2-[1-(ethylamino)ethyl]-3,5-difluorophenol |
|---|---|
| PubChem CID | 104581572 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-[1-(ethylamino)ethyl]-3,5-difluorophenol |
| SMILES | CCNC(C)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C10H13F2NO/c1-3-13-6(2)10-8(12)4-7(11)5-9(10)14/h4-6,13-14H,3H2,1-2H3 |
| InChIKey | MHZGLLLCJDCKOP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|