C17H26F2N2O2 — CID 97305905
2-[(1S)-1-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propylamino]ethyl]-3,5-difluorophenol (PubChem CID 97305905) has the molecular formula C17H26F2N2O2 and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-[(1S)-1-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propylamino]ethyl]-3,5-difluorophenol.
| Compound Name | 2-[(1S)-1-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propylamino]ethyl]-3,5-difluorophenol |
|---|---|
| PubChem CID | 97305905 |
| Molecular Formula | C17H26F2N2O2 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[(1S)-1-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propylamino]ethyl]-3,5-difluorophenol |
| SMILES | C[C@@H]1CN(CCCN[C@@H](C)c2c(O)cc(F)cc2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H26F2N2O2/c1-11-9-21(10-12(2)23-11)6-4-5-20-13(3)17-15(19)7-14(18)8-16(17)22/h7-8,11-13,20,22H,4-6,9-10H2,1-3H3/t11-,12-,13+/m1/s1 |
| InChIKey | CXCQZQPSKLONPX-UPJWGTAASA-N |
| XLogP | 2.82 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|