C14H18F3N — CID 43490426
N-[cyclopentyl-(2,4,6-trifluorophenyl)methyl]ethanamine (PubChem CID 43490426) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is N-[cyclopentyl-(2,4,6-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[cyclopentyl-(2,4,6-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43490426 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[cyclopentyl-(2,4,6-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1c(F)cc(F)cc1F)C1CCCC1 |
| InChI | InChI=1S/C14H18F3N/c1-2-18-14(9-5-3-4-6-9)13-11(16)7-10(15)8-12(13)17/h7-9,14,18H,2-6H2,1H3 |
| InChIKey | WTWRNQSDMZFCRV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |