C15H18F5N — CID 114981388
N-[cyclohexyl-(2,3,4,5,6-pentafluorophenyl)methyl]ethanamine (PubChem CID 114981388) has the molecular formula C15H18F5N and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[cyclohexyl-(2,3,4,5,6-pentafluorophenyl)methyl]ethanamine.
| Compound Name | N-[cyclohexyl-(2,3,4,5,6-pentafluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 114981388 |
| Molecular Formula | C15H18F5N |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[cyclohexyl-(2,3,4,5,6-pentafluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1c(F)c(F)c(F)c(F)c1F)C1CCCCC1 |
| InChI | InChI=1S/C15H18F5N/c1-2-21-15(8-6-4-3-5-7-8)9-10(16)12(18)14(20)13(19)11(9)17/h8,15,21H,2-7H2,1H3 |
| InChIKey | QNFJWDUSYBBLNU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|