C13H22N2S — CID 104583939
N-[2-(1,3-thiazol-2-yl)butan-2-yl]hex-5-en-2-amine (PubChem CID 104583939) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-2-yl)butan-2-yl]hex-5-en-2-amine.
| Compound Name | N-[2-(1,3-thiazol-2-yl)butan-2-yl]hex-5-en-2-amine |
|---|---|
| PubChem CID | 104583939 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-[2-(1,3-thiazol-2-yl)butan-2-yl]hex-5-en-2-amine |
| SMILES | C=CCCC(C)NC(C)(CC)c1nccs1 |
| InChI | InChI=1S/C13H22N2S/c1-5-7-8-11(3)15-13(4,6-2)12-14-9-10-16-12/h5,9-11,15H,1,6-8H2,2-4H3 |
| InChIKey | IDBWZGMVKJLGKV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|