C11H18N2S — CID 104582125
N-[2-(1,3-thiazol-2-yl)ethyl]hex-5-en-2-amine (PubChem CID 104582125) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-2-yl)ethyl]hex-5-en-2-amine.
| Compound Name | N-[2-(1,3-thiazol-2-yl)ethyl]hex-5-en-2-amine |
|---|---|
| PubChem CID | 104582125 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[2-(1,3-thiazol-2-yl)ethyl]hex-5-en-2-amine |
| SMILES | C=CCCC(C)NCCc1nccs1 |
| InChI | InChI=1S/C11H18N2S/c1-3-4-5-10(2)12-7-6-11-13-8-9-14-11/h3,8-10,12H,1,4-7H2,2H3 |
| InChIKey | UJLZVLMQAATJPG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|