C12H20N2S — CID 115715095
1-cyclobutyl-N-[2-(1,3-thiazol-2-yl)ethyl]propan-2-amine (PubChem CID 115715095) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-cyclobutyl-N-[2-(1,3-thiazol-2-yl)ethyl]propan-2-amine.
| Compound Name | 1-cyclobutyl-N-[2-(1,3-thiazol-2-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 115715095 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-cyclobutyl-N-[2-(1,3-thiazol-2-yl)ethyl]propan-2-amine |
| SMILES | CC(CC1CCC1)NCCc1nccs1 |
| InChI | InChI=1S/C12H20N2S/c1-10(9-11-3-2-4-11)13-6-5-12-14-7-8-15-12/h7-8,10-11,13H,2-6,9H2,1H3 |
| InChIKey | CJSDCBHOGSNIES-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |