C12H22N2OS — CID 115889738
4-methoxy-N-[4-(1,3-thiazol-2-yl)butyl]butan-2-amine (PubChem CID 115889738) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 4-methoxy-N-[4-(1,3-thiazol-2-yl)butyl]butan-2-amine.
| Compound Name | 4-methoxy-N-[4-(1,3-thiazol-2-yl)butyl]butan-2-amine |
|---|---|
| PubChem CID | 115889738 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-methoxy-N-[4-(1,3-thiazol-2-yl)butyl]butan-2-amine |
| SMILES | COCCC(C)NCCCCc1nccs1 |
| InChI | InChI=1S/C12H22N2OS/c1-11(6-9-15-2)13-7-4-3-5-12-14-8-10-16-12/h8,10-11,13H,3-7,9H2,1-2H3 |
| InChIKey | HLVGHILPPHMKEF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|