C24H31ClN2O5S — CID 10458453
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylsulfanyl)oxane-2,4-dione (PubChem CID 10458453) has the molecular formula C24H31ClN2O5S and a molecular weight of 495.04 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylsulfanyl)oxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylsulfanyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 10458453 |
| Molecular Formula | C24H31ClN2O5S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylsulfanyl)oxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(SC3=NCCCN3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C24H31ClN2O5S/c1-30-19-13-20(31-2)17(25)12-15(19)8-9-24(16-6-3-4-7-16)14-18(28)21(22(29)32-24)33-23-26-10-5-11-27-23/h12-13,16,21H,3-11,14H2,1-2H3,(H,26,27) |
| InChIKey | GDZZVUCJCIRHBV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|