C22H27ClN4O5S — CID 91141327
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(1-methyltetrazol-5-yl)sulfanyloxane-2,4-dione (PubChem CID 91141327) has the molecular formula C22H27ClN4O5S and a molecular weight of 495.00 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(1-methyltetrazol-5-yl)sulfanyloxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(1-methyltetrazol-5-yl)sulfanyloxane-2,4-dione |
|---|---|
| PubChem CID | 91141327 |
| Molecular Formula | C22H27ClN4O5S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-(1-methyltetrazol-5-yl)sulfanyloxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3nnnn3C)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C22H27ClN4O5S/c1-27-21(24-25-26-27)33-19-16(28)12-22(32-20(19)29,14-6-4-5-7-14)9-8-13-10-15(23)18(31-3)11-17(13)30-2/h10-11,14,19H,4-9,12H2,1-3H3 |
| InChIKey | DZGHIBXRJLREMI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|