C16H21NO3 — CID 104585216
N-[1-(1-benzofuran-2-yl)ethyl]-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 104585216) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 104585216 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CC(NC1COC(C)(C)OC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H21NO3/c1-11(17-13-9-18-16(2,3)19-10-13)15-8-12-6-4-5-7-14(12)20-15/h4-8,11,13,17H,9-10H2,1-3H3 |
| InChIKey | TWQHLWWKHGSAON-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |