C12H19NO2S — CID 104585287
2,2-dimethyl-N-(1-thiophen-3-ylethyl)-1,3-dioxan-5-amine (PubChem CID 104585287) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-(1-thiophen-3-ylethyl)-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-(1-thiophen-3-ylethyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 104585287 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2,2-dimethyl-N-(1-thiophen-3-ylethyl)-1,3-dioxan-5-amine |
| SMILES | CC(NC1COC(C)(C)OC1)c1ccsc1 |
| InChI | InChI=1S/C12H19NO2S/c1-9(10-4-5-16-8-10)13-11-6-14-12(2,3)15-7-11/h4-5,8-9,11,13H,6-7H2,1-3H3 |
| InChIKey | HWNUVAPYSISWLY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |