C11H21NO2 — CID 104588142
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-propan-2-yloxyethanamine (PubChem CID 104588142) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-propan-2-yloxyethanamine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 104588142 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2-propan-2-yloxyethanamine |
| SMILES | CC(C)OCCNCC1=CCCOC1 |
| InChI | InChI=1S/C11H21NO2/c1-10(2)14-7-5-12-8-11-4-3-6-13-9-11/h4,10,12H,3,5-9H2,1-2H3 |
| InChIKey | JCLOXSMZKVPEOA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|