C11H19NO — CID 143800433
2-cyclohexa-1,5-dien-1-yl-N-ethyl-2-methoxyethanamine (PubChem CID 143800433) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-N-ethyl-2-methoxyethanamine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-N-ethyl-2-methoxyethanamine |
|---|---|
| PubChem CID | 143800433 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-N-ethyl-2-methoxyethanamine |
| SMILES | CCNCC(OC)C1=CCCC=C1 |
| InChI | InChI=1S/C11H19NO/c1-3-12-9-11(13-2)10-7-5-4-6-8-10/h5,7-8,11-12H,3-4,6,9H2,1-2H3 |
| InChIKey | MCQYHPYGYTZHGY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |