C10H13F2NO — CID 178115857
6-cyclohexa-1,5-dien-1-yl-2,2-difluoromorpholine (PubChem CID 178115857) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-yl-2,2-difluoromorpholine.
| Compound Name | 6-cyclohexa-1,5-dien-1-yl-2,2-difluoromorpholine |
|---|---|
| PubChem CID | 178115857 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-yl-2,2-difluoromorpholine |
| SMILES | FC1(F)CNCC(C2=CCCC=C2)O1 |
| InChI | InChI=1S/C10H13F2NO/c11-10(12)7-13-6-9(14-10)8-4-2-1-3-5-8/h2,4-5,9,13H,1,3,6-7H2 |
| InChIKey | BAUQVKYUWSLCCZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |