C10H14FNO — CID 147833140
2-(4-fluorocyclohexa-1,5-dien-1-yl)morpholine (PubChem CID 147833140) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-(4-fluorocyclohexa-1,5-dien-1-yl)morpholine.
| Compound Name | 2-(4-fluorocyclohexa-1,5-dien-1-yl)morpholine |
|---|---|
| PubChem CID | 147833140 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-(4-fluorocyclohexa-1,5-dien-1-yl)morpholine |
| SMILES | FC1C=CC(C2CNCCO2)=CC1 |
| InChI | InChI=1S/C10H14FNO/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10/h1-3,9-10,12H,4-7H2 |
| InChIKey | HRMKKHBXXBMVBV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |