C9H13F2NO — CID 177151938
2,2-difluoro-6-[(3Z)-penta-1,3-dien-2-yl]morpholine (PubChem CID 177151938) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is 2,2-difluoro-6-[(3Z)-penta-1,3-dien-2-yl]morpholine.
| Compound Name | 2,2-difluoro-6-[(3Z)-penta-1,3-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 177151938 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2,2-difluoro-6-[(3Z)-penta-1,3-dien-2-yl]morpholine |
| SMILES | C=C(/C=C\C)C1CNCC(F)(F)O1 |
| InChI | InChI=1S/C9H13F2NO/c1-3-4-7(2)8-5-12-6-9(10,11)13-8/h3-4,8,12H,2,5-6H2,1H3/b4-3- |
| InChIKey | RSXRVSJGNWKXBM-ARJAWSKDSA-N |
| XLogP | 1.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|