C9H16FNO — CID 134224603
(E,2S)-4-fluoro-2-methoxy-N-methyl-3-methylidenehex-4-en-1-amine (PubChem CID 134224603) has the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. Its IUPAC name is (E,2S)-4-fluoro-2-methoxy-N-methyl-3-methylidenehex-4-en-1-amine.
| Compound Name | (E,2S)-4-fluoro-2-methoxy-N-methyl-3-methylidenehex-4-en-1-amine |
|---|---|
| PubChem CID | 134224603 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (E,2S)-4-fluoro-2-methoxy-N-methyl-3-methylidenehex-4-en-1-amine |
| SMILES | C=C(/C(F)=C\C)[C@@H](CNC)OC |
| InChI | InChI=1S/C9H16FNO/c1-5-8(10)7(2)9(12-4)6-11-3/h5,9,11H,2,6H2,1,3-4H3/b8-5+/t9-/m1/s1 |
| InChIKey | CPYZFXQZVDKGOA-WHXYTISESA-N |
| XLogP | 1.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|