C20H45NO7P2S — CID 10458833
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octylsulfanylpropan-2-yl]oxy-heptylphosphinic acid (PubChem CID 10458833) has the molecular formula C20H45NO7P2S and a molecular weight of 505.60 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octylsulfanylpropan-2-yl]oxy-heptylphosphinic acid.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octylsulfanylpropan-2-yl]oxy-heptylphosphinic acid |
|---|---|
| PubChem CID | 10458833 |
| Molecular Formula | C20H45NO7P2S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octylsulfanylpropan-2-yl]oxy-heptylphosphinic acid |
| SMILES | CCCCCCCCSC[C@@H](COP(=O)(O)OCCN)OP(=O)(O)CCCCCCC |
| InChI | InChI=1S/C20H45NO7P2S/c1-3-5-7-9-11-13-17-31-19-20(18-27-30(24,25)26-15-14-21)28-29(22,23)16-12-10-8-6-4-2/h20H,3-19,21H2,1-2H3,(H,22,23)(H,24,25)/t20-/m1/s1 |
| InChIKey | SDAFXUADXBYKIG-HXUWFJFHSA-N |
| XLogP | 5.71 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|