C22H48O7P2S — CID 10006826
[(2R)-1-[butoxy(hydroxy)phosphoryl]oxy-3-octylsulfanylpropan-2-yl]oxy-heptylphosphinic acid (PubChem CID 10006826) has the molecular formula C22H48O7P2S and a molecular weight of 518.63 g/mol. Its IUPAC name is [(2R)-1-[butoxy(hydroxy)phosphoryl]oxy-3-octylsulfanylpropan-2-yl]oxy-heptylphosphinic acid.
| Compound Name | [(2R)-1-[butoxy(hydroxy)phosphoryl]oxy-3-octylsulfanylpropan-2-yl]oxy-heptylphosphinic acid |
|---|---|
| PubChem CID | 10006826 |
| Molecular Formula | C22H48O7P2S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | [(2R)-1-[butoxy(hydroxy)phosphoryl]oxy-3-octylsulfanylpropan-2-yl]oxy-heptylphosphinic acid |
| SMILES | CCCCCCCCSC[C@@H](COP(=O)(O)OCCCC)OP(=O)(O)CCCCCCC |
| InChI | InChI=1S/C22H48O7P2S/c1-4-7-10-12-14-16-19-32-21-22(20-28-31(25,26)27-17-9-6-3)29-30(23,24)18-15-13-11-8-5-2/h22H,4-21H2,1-3H3,(H,23,24)(H,25,26)/t22-/m1/s1 |
| InChIKey | RCDSJXDFDXUSCM-JOCHJYFZSA-N |
| XLogP | 7.55 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|