C10H16N2O2S — CID 104588940
2,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-dioxan-5-amine (PubChem CID 104588940) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 104588940 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(NCc2cscn2)CO1 |
| InChI | InChI=1S/C10H16N2O2S/c1-10(2)13-4-9(5-14-10)11-3-8-6-15-7-12-8/h6-7,9,11H,3-5H2,1-2H3 |
| InChIKey | QSQCHEBTIWPHAM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |