C9H14N2S3 — CID 122557869
N-(1,3-thiazol-4-ylmethyl)-1,4-dithiepan-6-amine (PubChem CID 122557869) has the molecular formula C9H14N2S3 and a molecular weight of 246.43 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)-1,4-dithiepan-6-amine.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)-1,4-dithiepan-6-amine |
|---|---|
| PubChem CID | 122557869 |
| Molecular Formula | C9H14N2S3 |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)-1,4-dithiepan-6-amine |
| SMILES | c1nc(CNC2CSCCSC2)cs1 |
| InChI | InChI=1S/C9H14N2S3/c1-2-13-6-9(5-12-1)10-3-8-4-14-7-11-8/h4,7,9-10H,1-3,5-6H2 |
| InChIKey | YIDCOVJMTMHUFY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |