C11H13N5O4 — CID 104589155
1-(2-amino-5-nitropyridine-3-carbonyl)-1,4-diazepan-5-one (PubChem CID 104589155) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is 1-(2-amino-5-nitropyridine-3-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-amino-5-nitropyridine-3-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 104589155 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(2-amino-5-nitropyridine-3-carbonyl)-1,4-diazepan-5-one |
| SMILES | Nc1ncc([N+](=O)[O-])cc1C(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C11H13N5O4/c12-10-8(5-7(6-14-10)16(19)20)11(18)15-3-1-9(17)13-2-4-15/h5-6H,1-4H2,(H2,12,14)(H,13,17) |
| InChIKey | ZIJPBLHSUPZLHY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|