C10H14N4O4S — CID 104589277
2-amino-N-(2-ethylsulfinylethyl)-5-nitropyridine-3-carboxamide (PubChem CID 104589277) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-amino-N-(2-ethylsulfinylethyl)-5-nitropyridine-3-carboxamide.
| Compound Name | 2-amino-N-(2-ethylsulfinylethyl)-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 104589277 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-amino-N-(2-ethylsulfinylethyl)-5-nitropyridine-3-carboxamide |
| SMILES | CCS(=O)CCNC(=O)c1cc([N+](=O)[O-])cnc1N |
| InChI | InChI=1S/C10H14N4O4S/c1-2-19(18)4-3-12-10(15)8-5-7(14(16)17)6-13-9(8)11/h5-6H,2-4H2,1H3,(H2,11,13)(H,12,15) |
| InChIKey | YGOBSPXROGBIDF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|