C16H24ClNO2S — CID 104589740
N-[(2-chloro-6-methylsulfonylphenyl)methyl]-1-(3-methylcyclohexyl)methanamine (PubChem CID 104589740) has the molecular formula C16H24ClNO2S and a molecular weight of 329.89 g/mol. Its IUPAC name is N-[(2-chloro-6-methylsulfonylphenyl)methyl]-1-(3-methylcyclohexyl)methanamine.
| Compound Name | N-[(2-chloro-6-methylsulfonylphenyl)methyl]-1-(3-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 104589740 |
| Molecular Formula | C16H24ClNO2S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[(2-chloro-6-methylsulfonylphenyl)methyl]-1-(3-methylcyclohexyl)methanamine |
| SMILES | CC1CCCC(CNCc2c(Cl)cccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H24ClNO2S/c1-12-5-3-6-13(9-12)10-18-11-14-15(17)7-4-8-16(14)21(2,19)20/h4,7-8,12-13,18H,3,5-6,9-11H2,1-2H3 |
| InChIKey | ZUBXWKOYHOHNGK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |