C11H13BrClNO2S — CID 104589766
2-bromo-N-[(2-chloro-6-methylsulfonylphenyl)methyl]prop-2-en-1-amine (PubChem CID 104589766) has the molecular formula C11H13BrClNO2S and a molecular weight of 338.65 g/mol. Its IUPAC name is 2-bromo-N-[(2-chloro-6-methylsulfonylphenyl)methyl]prop-2-en-1-amine.
| Compound Name | 2-bromo-N-[(2-chloro-6-methylsulfonylphenyl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 104589766 |
| Molecular Formula | C11H13BrClNO2S |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 2-bromo-N-[(2-chloro-6-methylsulfonylphenyl)methyl]prop-2-en-1-amine |
| SMILES | C=C(Br)CNCc1c(Cl)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H13BrClNO2S/c1-8(12)6-14-7-9-10(13)4-3-5-11(9)17(2,15)16/h3-5,14H,1,6-7H2,2H3 |
| InChIKey | NWXXFBKJAFAHJZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |