C12H19ClN2O4S2 — CID 104589776
2-[(2-chloro-6-methylsulfonylphenyl)methylamino]-N-ethylethanesulfonamide (PubChem CID 104589776) has the molecular formula C12H19ClN2O4S2 and a molecular weight of 354.88 g/mol. Its IUPAC name is 2-[(2-chloro-6-methylsulfonylphenyl)methylamino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(2-chloro-6-methylsulfonylphenyl)methylamino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 104589776 |
| Molecular Formula | C12H19ClN2O4S2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-[(2-chloro-6-methylsulfonylphenyl)methylamino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNCc1c(Cl)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C12H19ClN2O4S2/c1-3-15-21(18,19)8-7-14-9-10-11(13)5-4-6-12(10)20(2,16)17/h4-6,14-15H,3,7-9H2,1-2H3 |
| InChIKey | MPSNSXBRFDFUIO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|