C11H17ClN2O4S2 — CID 102674823
2-[(2-chloro-6-methylsulfonylphenyl)methylamino]-N-methylethanesulfonamide (PubChem CID 102674823) has the molecular formula C11H17ClN2O4S2 and a molecular weight of 340.85 g/mol. Its IUPAC name is 2-[(2-chloro-6-methylsulfonylphenyl)methylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[(2-chloro-6-methylsulfonylphenyl)methylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 102674823 |
| Molecular Formula | C11H17ClN2O4S2 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-[(2-chloro-6-methylsulfonylphenyl)methylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1c(Cl)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H17ClN2O4S2/c1-13-20(17,18)7-6-14-8-9-10(12)4-3-5-11(9)19(2,15)16/h3-5,13-14H,6-8H2,1-2H3 |
| InChIKey | DLEHOFKXLHGFDJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|