C11H13NO2S — CID 104590202
2-(3-hydroxyphenyl)sulfanyl-N-prop-2-enylacetamide (PubChem CID 104590202) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)sulfanyl-N-prop-2-enylacetamide.
| Compound Name | 2-(3-hydroxyphenyl)sulfanyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 104590202 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-(3-hydroxyphenyl)sulfanyl-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1cccc(O)c1 |
| InChI | InChI=1S/C11H13NO2S/c1-2-6-12-11(14)8-15-10-5-3-4-9(13)7-10/h2-5,7,13H,1,6,8H2,(H,12,14) |
| InChIKey | DIRBOWRFSLFAQA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|