C13H18N2O3S — CID 104590290
N-(butylcarbamoyl)-2-(3-hydroxyphenyl)sulfanylacetamide (PubChem CID 104590290) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-(3-hydroxyphenyl)sulfanylacetamide.
| Compound Name | N-(butylcarbamoyl)-2-(3-hydroxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 104590290 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(butylcarbamoyl)-2-(3-hydroxyphenyl)sulfanylacetamide |
| SMILES | CCCCNC(=O)NC(=O)CSc1cccc(O)c1 |
| InChI | InChI=1S/C13H18N2O3S/c1-2-3-7-14-13(18)15-12(17)9-19-11-6-4-5-10(16)8-11/h4-6,8,16H,2-3,7,9H2,1H3,(H2,14,15,17,18) |
| InChIKey | QZLLATKYZGRZCU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|