C13H16N2O2S — CID 104590238
3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenol (PubChem CID 104590238) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenol.
| Compound Name | 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 104590238 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]phenol |
| SMILES | CC(C)(C)c1nc(CSc2cccc(O)c2)no1 |
| InChI | InChI=1S/C13H16N2O2S/c1-13(2,3)12-14-11(15-17-12)8-18-10-6-4-5-9(16)7-10/h4-7,16H,8H2,1-3H3 |
| InChIKey | QYUHMELHUQIHGR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |