C12H7F3N4O2 — CID 104593100
N-(4-cyano-1-methylpyrazol-3-yl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 104593100) has the molecular formula C12H7F3N4O2 and a molecular weight of 296.21 g/mol. Its IUPAC name is N-(4-cyano-1-methylpyrazol-3-yl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(4-cyano-1-methylpyrazol-3-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 104593100 |
| Molecular Formula | C12H7F3N4O2 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-(4-cyano-1-methylpyrazol-3-yl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | Cn1cc(C#N)c(NC(=O)c2cc(F)c(F)c(O)c2F)n1 |
| InChI | InChI=1S/C12H7F3N4O2/c1-19-4-5(3-16)11(18-19)17-12(21)6-2-7(13)9(15)10(20)8(6)14/h2,4,20H,1H3,(H,17,18,21) |
| InChIKey | YPVCSMMNNMBNNF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|