C13H23N3O2 — CID 104593851
N-[2-(2-hydroxypropylamino)ethyl]-1-propylpyrrole-2-carboxamide (PubChem CID 104593851) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-[2-(2-hydroxypropylamino)ethyl]-1-propylpyrrole-2-carboxamide.
| Compound Name | N-[2-(2-hydroxypropylamino)ethyl]-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104593851 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-[2-(2-hydroxypropylamino)ethyl]-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cccc1C(=O)NCCNCC(C)O |
| InChI | InChI=1S/C13H23N3O2/c1-3-8-16-9-4-5-12(16)13(18)15-7-6-14-10-11(2)17/h4-5,9,11,14,17H,3,6-8,10H2,1-2H3,(H,15,18) |
| InChIKey | YSRANKJBMCUPKJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|