C15H18N2O2 — CID 114332469
N-[(2-hydroxyphenyl)methyl]-1-propylpyrrole-2-carboxamide (PubChem CID 114332469) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[(2-hydroxyphenyl)methyl]-1-propylpyrrole-2-carboxamide.
| Compound Name | N-[(2-hydroxyphenyl)methyl]-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114332469 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-[(2-hydroxyphenyl)methyl]-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cccc1C(=O)NCc1ccccc1O |
| InChI | InChI=1S/C15H18N2O2/c1-2-9-17-10-5-7-13(17)15(19)16-11-12-6-3-4-8-14(12)18/h3-8,10,18H,2,9,11H2,1H3,(H,16,19) |
| InChIKey | NIOSTFHOZMLOFY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|